C8H4ClF6N — CID 2757429
2-chloro-3,5-bis(trifluoromethyl)aniline (PubChem CID 2757429) has the molecular formula C8H4ClF6N and a molecular weight of 263.57 g/mol. Its IUPAC name is 2-chloro-3,5-bis(trifluoromethyl)aniline.
| Compound Name | 2-chloro-3,5-bis(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 2757429 |
| Molecular Formula | C8H4ClF6N |
| Molecular Weight | 263.57 g/mol |
| Exact Mass | 262.99 |
| IUPAC Name | 2-chloro-3,5-bis(trifluoromethyl)aniline |
| SMILES | Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C8H4ClF6N/c9-6-4(8(13,14)15)1-3(2-5(6)16)7(10,11)12/h1-2H,16H2 |
| InChIKey | JKUFETFGEJPHEM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.57 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|