About 2-amino-4,6-bis(trifluoromethyl)benzoate
2-amino-4,6-bis(trifluoromethyl)benzoate (PubChem CID 86336027) has the molecular formula C9H4F6NO2-
and a molecular weight of 272.12 g/mol. Its IUPAC name is 2-amino-4,6-bis(trifluoromethyl)benzoate.
Molecular Properties
| Compound Name | 2-amino-4,6-bis(trifluoromethyl)benzoate |
| PubChem CID | 86336027 |
| Molecular Formula | C9H4F6NO2- |
| Molecular Weight | 272.12 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 2-amino-4,6-bis(trifluoromethyl)benzoate |
| SMILES | Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1C(=O)[O-] |
| InChI | InChI=1S/C9H5F6NO2/c10-8(11,12)3-1-4(9(13,14)15)6(7(17)18)5(16)2-3/h1-2H,16H2,(H,17,18)/p-1 |
| InChIKey | BROYIYLWBSRTNS-UHFFFAOYSA-M |
| XLogP | 1.67 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.12 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4,6-bis(trifluoromethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4,6-bis(trifluoromethyl)benzoate?
The IUPAC name of 2-amino-4,6-bis(trifluoromethyl)benzoate (CID 86336027) is 2-amino-4,6-bis(trifluoromethyl)benzoate.
What is the SMILES notation for 2-amino-4,6-bis(trifluoromethyl)benzoate?
The canonical SMILES for 2-amino-4,6-bis(trifluoromethyl)benzoate is Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1C(=O)[O-].
What is the InChIKey of 2-amino-4,6-bis(trifluoromethyl)benzoate?
The InChIKey is BROYIYLWBSRTNS-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H5F6NO2/c10-8(11,12)3-1-4(9(13,14)15)6(7(17)18)5(16)2-3/h1-2H,16H2,(H,17,18)/p-1.
What are the key properties of 2-amino-4,6-bis(trifluoromethyl)benzoate?
2-amino-4,6-bis(trifluoromethyl)benzoate has a molecular weight of 272.12 g/mol, XLogP of 1.67, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4,6-bis(trifluoromethyl)benzoate is sourced from PubChem (CID 86336027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).