C9H4F6NO2- — CID 86336027
2-amino-4,6-bis(trifluoromethyl)benzoate (PubChem CID 86336027) has the molecular formula C9H4F6NO2- and a molecular weight of 272.12 g/mol. Its IUPAC name is 2-amino-4,6-bis(trifluoromethyl)benzoate.
| Compound Name | 2-amino-4,6-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 86336027 |
| Molecular Formula | C9H4F6NO2- |
| Molecular Weight | 272.12 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 2-amino-4,6-bis(trifluoromethyl)benzoate |
| SMILES | Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1C(=O)[O-] |
| InChI | InChI=1S/C9H5F6NO2/c10-8(11,12)3-1-4(9(13,14)15)6(7(17)18)5(16)2-3/h1-2H,16H2,(H,17,18)/p-1 |
| InChIKey | BROYIYLWBSRTNS-UHFFFAOYSA-M |
| XLogP | 1.67 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.12 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|