C21H17BrF12N2O3 — CID 162248209
2-amino-4,6-bis(trifluoromethyl)phenol;2-bromo-N-[2-hydroxy-3,5-bis(trifluoromethyl)phenyl]-3-methylbutanamide (PubChem CID 162248209) has the molecular formula C21H17BrF12N2O3 and a molecular weight of 653.26 g/mol. Its IUPAC name is 2-amino-4,6-bis(trifluoromethyl)phenol;2-bromo-N-[2-hydroxy-3,5-bis(trifluoromethyl)phenyl]-3-methylbutanamide.
| Compound Name | 2-amino-4,6-bis(trifluoromethyl)phenol;2-bromo-N-[2-hydroxy-3,5-bis(trifluoromethyl)phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 162248209 |
| Molecular Formula | C21H17BrF12N2O3 |
| Molecular Weight | 653.26 g/mol |
| Exact Mass | 652.02 |
| IUPAC Name | 2-amino-4,6-bis(trifluoromethyl)phenol;2-bromo-N-[2-hydroxy-3,5-bis(trifluoromethyl)phenyl]-3-methylbutanamide |
| SMILES | CC(C)C(Br)C(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1O.Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1O |
| InChI | InChI=1S/C13H12BrF6NO2.C8H5F6NO/c1-5(2)9(14)11(23)21-8-4-6(12(15,16)17)3-7(10(8)22)13(18,19)20;9-7(10,11)3-1-4(8(12,13)14)6(16)5(15)2-3/h3-5,9,22H,1-2H3,(H,21,23);1-2,16H,15H2 |
| InChIKey | ZXQANUSHYFIRRS-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.26 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|