C9H7F6N3O2 — CID 171837231
1-amino-3-[2-hydroxy-3,5-bis(trifluoromethyl)phenyl]urea (PubChem CID 171837231) has the molecular formula C9H7F6N3O2 and a molecular weight of 303.16 g/mol. Its IUPAC name is 1-amino-3-[2-hydroxy-3,5-bis(trifluoromethyl)phenyl]urea.
| Compound Name | 1-amino-3-[2-hydroxy-3,5-bis(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 171837231 |
| Molecular Formula | C9H7F6N3O2 |
| Molecular Weight | 303.16 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 1-amino-3-[2-hydroxy-3,5-bis(trifluoromethyl)phenyl]urea |
| SMILES | NNC(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1O |
| InChI | InChI=1S/C9H7F6N3O2/c10-8(11,12)3-1-4(9(13,14)15)6(19)5(2-3)17-7(20)18-16/h1-2,19H,16H2,(H2,17,18,20) |
| InChIKey | IJDMWJBCMOTVLW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.16 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|