C12H20ClN3O3 — CID 22099496
1-amino-3-(3-tert-butyl-2-hydroxy-5-methoxyphenyl)urea;hydrochloride (PubChem CID 22099496) has the molecular formula C12H20ClN3O3 and a molecular weight of 289.76 g/mol. Its IUPAC name is 1-amino-3-(3-tert-butyl-2-hydroxy-5-methoxyphenyl)urea;hydrochloride.
| Compound Name | 1-amino-3-(3-tert-butyl-2-hydroxy-5-methoxyphenyl)urea;hydrochloride |
|---|---|
| PubChem CID | 22099496 |
| Molecular Formula | C12H20ClN3O3 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 1-amino-3-(3-tert-butyl-2-hydroxy-5-methoxyphenyl)urea;hydrochloride |
| SMILES | COc1cc(NC(=O)NN)c(O)c(C(C)(C)C)c1.Cl |
| InChI | InChI=1S/C12H19N3O3.ClH/c1-12(2,3)8-5-7(18-4)6-9(10(8)16)14-11(17)15-13;/h5-6,16H,13H2,1-4H3,(H2,14,15,17);1H |
| InChIKey | ZVIMUGAFMVNDOX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|