C18H24N4O2 — CID 22099403
1-(3-tert-butyl-2-hydroxy-5-methoxyphenyl)-2-(pyridin-3-ylmethyl)guanidine (PubChem CID 22099403) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 1-(3-tert-butyl-2-hydroxy-5-methoxyphenyl)-2-(pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-(3-tert-butyl-2-hydroxy-5-methoxyphenyl)-2-(pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 22099403 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 1-(3-tert-butyl-2-hydroxy-5-methoxyphenyl)-2-(pyridin-3-ylmethyl)guanidine |
| SMILES | COc1cc(N/C(N)=N/Cc2cccnc2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H24N4O2/c1-18(2,3)14-8-13(24-4)9-15(16(14)23)22-17(19)21-11-12-6-5-7-20-10-12/h5-10,23H,11H2,1-4H3,(H3,19,21,22) |
| InChIKey | OIVYHKWTJQBPHZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 92.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|