C21H28N2O2 — CID 170984159
4,6-ditert-butyl-3-(pyridin-3-ylmethyliminomethyl)benzene-1,2-diol (PubChem CID 170984159) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 4,6-ditert-butyl-3-(pyridin-3-ylmethyliminomethyl)benzene-1,2-diol.
| Compound Name | 4,6-ditert-butyl-3-(pyridin-3-ylmethyliminomethyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 170984159 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 4,6-ditert-butyl-3-(pyridin-3-ylmethyliminomethyl)benzene-1,2-diol |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(/C=N/Cc2cccnc2)c(O)c1O |
| InChI | InChI=1S/C21H28N2O2/c1-20(2,3)16-10-17(21(4,5)6)19(25)18(24)15(16)13-23-12-14-8-7-9-22-11-14/h7-11,13,24-25H,12H2,1-6H3/b23-13+ |
| InChIKey | FWNQRAGGQGIPSX-YDZHTSKRSA-N |
| XLogP | 4.71 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|