C13H10I2N2O — CID 135869135
2,4-diiodo-6-(pyridin-3-ylmethyliminomethyl)phenol (PubChem CID 135869135) has the molecular formula C13H10I2N2O and a molecular weight of 464.04 g/mol. Its IUPAC name is 2,4-diiodo-6-(pyridin-3-ylmethyliminomethyl)phenol.
| Compound Name | 2,4-diiodo-6-(pyridin-3-ylmethyliminomethyl)phenol |
|---|---|
| PubChem CID | 135869135 |
| Molecular Formula | C13H10I2N2O |
| Molecular Weight | 464.04 g/mol |
| Exact Mass | 463.89 |
| IUPAC Name | 2,4-diiodo-6-(pyridin-3-ylmethyliminomethyl)phenol |
| SMILES | Oc1c(I)cc(I)cc1/C=N/Cc1cccnc1 |
| InChI | InChI=1S/C13H10I2N2O/c14-11-4-10(13(18)12(15)5-11)8-17-7-9-2-1-3-16-6-9/h1-6,8,18H,7H2/b17-8+ |
| InChIKey | MSVCUKYVZYIMLW-CAOOACKPSA-N |
| XLogP | 3.62 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.04 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|