C13H12N2O2 — CID 135936172
4-(pyridin-3-ylmethyliminomethyl)benzene-1,3-diol (PubChem CID 135936172) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is 4-(pyridin-3-ylmethyliminomethyl)benzene-1,3-diol.
| Compound Name | 4-(pyridin-3-ylmethyliminomethyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 135936172 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 4-(pyridin-3-ylmethyliminomethyl)benzene-1,3-diol |
| SMILES | Oc1ccc(/C=N/Cc2cccnc2)c(O)c1 |
| InChI | InChI=1S/C13H12N2O2/c16-12-4-3-11(13(17)6-12)9-15-8-10-2-1-5-14-7-10/h1-7,9,16-17H,8H2/b15-9+ |
| InChIKey | PBRYCEAKHRQIDC-OQLLNIDSSA-N |
| XLogP | 2.11 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|