C26H24N4NiO4 — CID 3688663
nickel;bis(4-(pyridin-2-ylmethyliminomethyl)benzene-1,3-diol) (PubChem CID 3688663) has the molecular formula C26H24N4NiO4 and a molecular weight of 515.20 g/mol. Its IUPAC name is nickel;bis(4-(pyridin-2-ylmethyliminomethyl)benzene-1,3-diol).
| Compound Name | nickel;bis(4-(pyridin-2-ylmethyliminomethyl)benzene-1,3-diol) |
|---|---|
| PubChem CID | 3688663 |
| Molecular Formula | C26H24N4NiO4 |
| Molecular Weight | 515.20 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | nickel;bis(4-(pyridin-2-ylmethyliminomethyl)benzene-1,3-diol) |
| SMILES | Oc1ccc(/C=N/Cc2ccccn2)c(O)c1.Oc1ccc(C=NCc2ccccn2)c(O)c1.[Ni] |
| InChI | InChI=1S/2C13H12N2O2.Ni/c2*16-12-5-4-10(13(17)7-12)8-14-9-11-3-1-2-6-15-11;/h2*1-8,16-17H,9H2;/b14-8+;; |
| InChIKey | XGGMWSNPYUHPNW-JPMXUBAOSA-N |
| XLogP | 4.22 |
| TPSA | 131.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.20 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|