C14H14N2O2 — CID 136738932
2-(2-pyridin-2-ylethyliminomethyl)benzene-1,4-diol (PubChem CID 136738932) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-(2-pyridin-2-ylethyliminomethyl)benzene-1,4-diol.
| Compound Name | 2-(2-pyridin-2-ylethyliminomethyl)benzene-1,4-diol |
|---|---|
| PubChem CID | 136738932 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-(2-pyridin-2-ylethyliminomethyl)benzene-1,4-diol |
| SMILES | Oc1ccc(O)c(/C=N/CCc2ccccn2)c1 |
| InChI | InChI=1S/C14H14N2O2/c17-13-4-5-14(18)11(9-13)10-15-8-6-12-3-1-2-7-16-12/h1-5,7,9-10,17-18H,6,8H2/b15-10+ |
| InChIKey | MTPJXNUALNKLPQ-XNTDXEJSSA-N |
| XLogP | 2.15 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|