C11H17N3O2 — CID 136801162
2-[2-(2-aminoethylamino)ethyliminomethyl]benzene-1,4-diol (PubChem CID 136801162) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is 2-[2-(2-aminoethylamino)ethyliminomethyl]benzene-1,4-diol.
| Compound Name | 2-[2-(2-aminoethylamino)ethyliminomethyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 136801162 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 2-[2-(2-aminoethylamino)ethyliminomethyl]benzene-1,4-diol |
| SMILES | NCCNCC/N=C/c1cc(O)ccc1O |
| InChI | InChI=1S/C11H17N3O2/c12-3-4-13-5-6-14-8-9-7-10(15)1-2-11(9)16/h1-2,7-8,13,15-16H,3-6,12H2/b14-8+ |
| InChIKey | MQRFSVUHJANSSD-RIYZIHGNSA-N |
| XLogP | 0.06 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|