C28H42N4O2 — CID 135587662
2-[3-[2-[3-[(2-hydroxy-5-propan-2-ylphenyl)methylideneamino]propylamino]ethylamino]propyliminomethyl]-4-propan-2-ylphenol (PubChem CID 135587662) has the molecular formula C28H42N4O2 and a molecular weight of 466.67 g/mol. Its IUPAC name is 2-[3-[2-[3-[(2-hydroxy-5-propan-2-ylphenyl)methylideneamino]propylamino]ethylamino]propyliminomethyl]-4-propan-2-ylphenol.
| Compound Name | 2-[3-[2-[3-[(2-hydroxy-5-propan-2-ylphenyl)methylideneamino]propylamino]ethylamino]propyliminomethyl]-4-propan-2-ylphenol |
|---|---|
| PubChem CID | 135587662 |
| Molecular Formula | C28H42N4O2 |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.33 |
| IUPAC Name | 2-[3-[2-[3-[(2-hydroxy-5-propan-2-ylphenyl)methylideneamino]propylamino]ethylamino]propyliminomethyl]-4-propan-2-ylphenol |
| SMILES | CC(C)c1ccc(O)c(/C=N/CCCNCCNCCC/N=C/c2cc(C(C)C)ccc2O)c1 |
| InChI | InChI=1S/C28H42N4O2/c1-21(2)23-7-9-27(33)25(17-23)19-31-13-5-11-29-15-16-30-12-6-14-32-20-26-18-24(22(3)4)8-10-28(26)34/h7-10,17-22,29-30,33-34H,5-6,11-16H2,1-4H3/b31-19+,32-20+ |
| InChIKey | WJUKIFNKSMOXAS-GKTLAHRSSA-N |
| XLogP | 4.84 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|