C7H7NO3 — CID 135483979
2-[(E)-hydroxyiminomethyl]benzene-1,4-diol (PubChem CID 135483979) has the molecular formula C7H7NO3 and a molecular weight of 153.14 g/mol. Its IUPAC name is 2-[(E)-hydroxyiminomethyl]benzene-1,4-diol.
| Compound Name | 2-[(E)-hydroxyiminomethyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 135483979 |
| Molecular Formula | C7H7NO3 |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.04 |
| IUPAC Name | 2-[(E)-hydroxyiminomethyl]benzene-1,4-diol |
| SMILES | O/N=C/c1cc(O)ccc1O |
| InChI | InChI=1S/C7H7NO3/c9-6-1-2-7(10)5(3-6)4-8-11/h1-4,9-11H/b8-4+ |
| InChIKey | XHBLHEQHMFWIIJ-XBXARRHUSA-N |
| XLogP | 0.91 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|