C11H14O2 — CID 145071373
2-[(Z)-3-methylbut-1-enyl]benzene-1,4-diol (PubChem CID 145071373) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 2-[(Z)-3-methylbut-1-enyl]benzene-1,4-diol.
| Compound Name | 2-[(Z)-3-methylbut-1-enyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 145071373 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 2-[(Z)-3-methylbut-1-enyl]benzene-1,4-diol |
| SMILES | CC(C)/C=C\c1cc(O)ccc1O |
| InChI | InChI=1S/C11H14O2/c1-8(2)3-4-9-7-10(12)5-6-11(9)13/h3-8,12-13H,1-2H3/b4-3- |
| InChIKey | MDFSLWOKDIYSJI-ARJAWSKDSA-N |
| XLogP | 2.77 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|