C14H12O4S — CID 176768110
(E)-3-(2,5-dihydroxyphenyl)-1-(5-methoxythiophen-2-yl)prop-2-en-1-one (PubChem CID 176768110) has the molecular formula C14H12O4S and a molecular weight of 276.31 g/mol. Its IUPAC name is (E)-3-(2,5-dihydroxyphenyl)-1-(5-methoxythiophen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(2,5-dihydroxyphenyl)-1-(5-methoxythiophen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 176768110 |
| Molecular Formula | C14H12O4S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | (E)-3-(2,5-dihydroxyphenyl)-1-(5-methoxythiophen-2-yl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2cc(O)ccc2O)s1 |
| InChI | InChI=1S/C14H12O4S/c1-18-14-7-6-13(19-14)12(17)4-2-9-8-10(15)3-5-11(9)16/h2-8,15-16H,1H3/b4-2+ |
| InChIKey | CDMLVEWZPKKFMK-DUXPYHPUSA-N |
| XLogP | 3.06 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|