C17H17NO3 — CID 102469351
(Z)-3-(2,5-dihydroxyphenyl)-1-[4-(dimethylamino)phenyl]prop-2-en-1-one (PubChem CID 102469351) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is (Z)-3-(2,5-dihydroxyphenyl)-1-[4-(dimethylamino)phenyl]prop-2-en-1-one.
| Compound Name | (Z)-3-(2,5-dihydroxyphenyl)-1-[4-(dimethylamino)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 102469351 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (Z)-3-(2,5-dihydroxyphenyl)-1-[4-(dimethylamino)phenyl]prop-2-en-1-one |
| SMILES | CN(C)c1ccc(C(=O)/C=C\c2cc(O)ccc2O)cc1 |
| InChI | InChI=1S/C17H17NO3/c1-18(2)14-6-3-12(4-7-14)16(20)9-5-13-11-15(19)8-10-17(13)21/h3-11,19,21H,1-2H3/b9-5- |
| InChIKey | BJLMTDLCDGWWBD-UITAMQMPSA-N |
| XLogP | 3.06 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|