C17H15NO3-2 — CID 101361692
4-[(Z)-3-[4-(dimethylamino)phenyl]-3-oxoprop-1-enyl]benzene-1,3-diolate (PubChem CID 101361692) has the molecular formula C17H15NO3-2 and a molecular weight of 281.31 g/mol. Its IUPAC name is 4-[(Z)-3-[4-(dimethylamino)phenyl]-3-oxoprop-1-enyl]benzene-1,3-diolate.
| Compound Name | 4-[(Z)-3-[4-(dimethylamino)phenyl]-3-oxoprop-1-enyl]benzene-1,3-diolate |
|---|---|
| PubChem CID | 101361692 |
| Molecular Formula | C17H15NO3-2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 4-[(Z)-3-[4-(dimethylamino)phenyl]-3-oxoprop-1-enyl]benzene-1,3-diolate |
| SMILES | CN(C)c1ccc(C(=O)/C=C\c2ccc([O-])cc2[O-])cc1 |
| InChI | InChI=1S/C17H17NO3/c1-18(2)14-7-3-12(4-8-14)16(20)10-6-13-5-9-15(19)11-17(13)21/h3-11,19,21H,1-2H3/p-2/b10-6- |
| InChIKey | PSWHQNPDHQZAGT-POHAHGRESA-L |
| XLogP | 1.80 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|