C9H12N2O2 — CID 135532292
2-[(E)-(dimethylhydrazinylidene)methyl]benzene-1,4-diol (PubChem CID 135532292) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 2-[(E)-(dimethylhydrazinylidene)methyl]benzene-1,4-diol.
| Compound Name | 2-[(E)-(dimethylhydrazinylidene)methyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 135532292 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 2-[(E)-(dimethylhydrazinylidene)methyl]benzene-1,4-diol |
| SMILES | CN(C)/N=C/c1cc(O)ccc1O |
| InChI | InChI=1S/C9H12N2O2/c1-11(2)10-6-7-5-8(12)3-4-9(7)13/h3-6,12-13H,1-2H3/b10-6+ |
| InChIKey | PMMXASGLAPXSIH-UXBLZVDNSA-N |
| XLogP | 0.99 |
| TPSA | 56.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|