C19H13N3O2S — CID 164706159
2-[(E)-[1,3-benzothiazol-2-yl(penta-1,3-diynyl)hydrazinylidene]methyl]benzene-1,4-diol (PubChem CID 164706159) has the molecular formula C19H13N3O2S and a molecular weight of 347.40 g/mol. Its IUPAC name is 2-[(E)-[1,3-benzothiazol-2-yl(penta-1,3-diynyl)hydrazinylidene]methyl]benzene-1,4-diol.
| Compound Name | 2-[(E)-[1,3-benzothiazol-2-yl(penta-1,3-diynyl)hydrazinylidene]methyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 164706159 |
| Molecular Formula | C19H13N3O2S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 2-[(E)-[1,3-benzothiazol-2-yl(penta-1,3-diynyl)hydrazinylidene]methyl]benzene-1,4-diol |
| SMILES | CC#CC#CN(/N=C/c1cc(O)ccc1O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H13N3O2S/c1-2-3-6-11-22(19-21-16-7-4-5-8-18(16)25-19)20-13-14-12-15(23)9-10-17(14)24/h4-5,7-10,12-13,23-24H,1H3/b20-13+ |
| InChIKey | QWZRPKDNNFTMAS-DEDYPNTBSA-N |
| XLogP | 3.53 |
| TPSA | 68.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|