C19H21N3S — CID 129146480
N-[(E)-(2,5-dimethylphenyl)methylideneamino]-N-propan-2-yl-1,3-benzothiazol-2-amine (PubChem CID 129146480) has the molecular formula C19H21N3S and a molecular weight of 323.47 g/mol. Its IUPAC name is N-[(E)-(2,5-dimethylphenyl)methylideneamino]-N-propan-2-yl-1,3-benzothiazol-2-amine.
| Compound Name | N-[(E)-(2,5-dimethylphenyl)methylideneamino]-N-propan-2-yl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 129146480 |
| Molecular Formula | C19H21N3S |
| Molecular Weight | 323.47 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | N-[(E)-(2,5-dimethylphenyl)methylideneamino]-N-propan-2-yl-1,3-benzothiazol-2-amine |
| SMILES | Cc1ccc(C)c(/C=N/N(c2nc3ccccc3s2)C(C)C)c1 |
| InChI | InChI=1S/C19H21N3S/c1-13(2)22(19-21-17-7-5-6-8-18(17)23-19)20-12-16-11-14(3)9-10-15(16)4/h5-13H,1-4H3/b20-12+ |
| InChIKey | FBWIWZYMRJJYJM-UDWIEESQSA-N |
| XLogP | 5.16 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|