C29H37N3OS — CID 137167290
2-[(E)-[1,3-benzothiazol-2-yl(cyclohexyl)hydrazinylidene]methyl]-4-(4-propylcyclohexyl)phenol (PubChem CID 137167290) has the molecular formula C29H37N3OS and a molecular weight of 475.70 g/mol. Its IUPAC name is 2-[(E)-[1,3-benzothiazol-2-yl(cyclohexyl)hydrazinylidene]methyl]-4-(4-propylcyclohexyl)phenol.
| Compound Name | 2-[(E)-[1,3-benzothiazol-2-yl(cyclohexyl)hydrazinylidene]methyl]-4-(4-propylcyclohexyl)phenol |
|---|---|
| PubChem CID | 137167290 |
| Molecular Formula | C29H37N3OS |
| Molecular Weight | 475.70 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | 2-[(E)-[1,3-benzothiazol-2-yl(cyclohexyl)hydrazinylidene]methyl]-4-(4-propylcyclohexyl)phenol |
| SMILES | CCCC1CCC(c2ccc(O)c(/C=N/N(c3nc4ccccc4s3)C3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C29H37N3OS/c1-2-8-21-13-15-22(16-14-21)23-17-18-27(33)24(19-23)20-30-32(25-9-4-3-5-10-25)29-31-26-11-6-7-12-28(26)34-29/h6-7,11-12,17-22,25,33H,2-5,8-10,13-16H2,1H3/b30-20+ |
| InChIKey | FLOUDZLEZDAGJC-TWKHWXDSSA-N |
| XLogP | 8.25 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.70 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|