C18H16F3N3O2S — CID 137101434
2-[[1,3-benzothiazol-2-yl(4,4,4-trifluorobutyl)hydrazinylidene]methyl]benzene-1,4-diol (PubChem CID 137101434) has the molecular formula C18H16F3N3O2S and a molecular weight of 395.41 g/mol. Its IUPAC name is 2-[[1,3-benzothiazol-2-yl(4,4,4-trifluorobutyl)hydrazinylidene]methyl]benzene-1,4-diol.
| Compound Name | 2-[[1,3-benzothiazol-2-yl(4,4,4-trifluorobutyl)hydrazinylidene]methyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 137101434 |
| Molecular Formula | C18H16F3N3O2S |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 2-[[1,3-benzothiazol-2-yl(4,4,4-trifluorobutyl)hydrazinylidene]methyl]benzene-1,4-diol |
| SMILES | Oc1ccc(O)c(C=NN(CCCC(F)(F)F)c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C18H16F3N3O2S/c19-18(20,21)8-3-9-24(17-23-14-4-1-2-5-16(14)27-17)22-11-12-10-13(25)6-7-15(12)26/h1-2,4-7,10-11,25-26H,3,8-9H2 |
| InChIKey | SNXSTRYBOTZEEX-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 68.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|