C42H44F3N3O9S — CID 137395097
4-O-[2-[(E)-[1,3-benzothiazol-2-yl(4,4,4-trifluorobutyl)hydrazinylidene]methyl]-4-formyloxyphenyl] 1-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] cyclohexane-1,4-dicarboxylate (PubChem CID 137395097) has the molecular formula C42H44F3N3O9S and a molecular weight of 823.89 g/mol. Its IUPAC name is 4-O-[2-[(E)-[1,3-benzothiazol-2-yl(4,4,4-trifluorobutyl)hydrazinylidene]methyl]-4-formyloxyphenyl] 1-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-[2-[(E)-[1,3-benzothiazol-2-yl(4,4,4-trifluorobutyl)hydrazinylidene]methyl]-4-formyloxyphenyl] 1-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 137395097 |
| Molecular Formula | C42H44F3N3O9S |
| Molecular Weight | 823.89 g/mol |
| Exact Mass | 823.28 |
| IUPAC Name | 4-O-[2-[(E)-[1,3-benzothiazol-2-yl(4,4,4-trifluorobutyl)hydrazinylidene]methyl]-4-formyloxyphenyl] 1-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] cyclohexane-1,4-dicarboxylate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(OC(=O)C2CCC(C(=O)Oc3ccc(OC=O)cc3/C=N/N(CCCC(F)(F)F)c3nc4ccccc4s3)CC2)cc1 |
| InChI | InChI=1S/C42H44F3N3O9S/c1-2-38(50)54-25-8-4-3-7-24-53-32-16-18-33(19-17-32)56-39(51)29-12-14-30(15-13-29)40(52)57-36-21-20-34(55-28-49)26-31(36)27-46-48(23-9-22-42(43,44)45)41-47-35-10-5-6-11-37(35)58-41/h2,5-6,10-11,16-21,26-30H,1,3-4,7-9,12-15,22-25H2/b46-27+ |
| InChIKey | AGMSOPPWSFQRAE-FMBFATOISA-N |
| XLogP | 9.00 |
| TPSA | 142.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.89 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|