C46H47N3O9S — CID 135128365
4-O-[2-[(E)-[1,3-benzothiazol-2-yl(phenacyl)hydrazinylidene]methyl]-4-methoxyphenyl] 1-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] cyclohexane-1,4-dicarboxylate (PubChem CID 135128365) has the molecular formula C46H47N3O9S and a molecular weight of 817.96 g/mol. Its IUPAC name is 4-O-[2-[(E)-[1,3-benzothiazol-2-yl(phenacyl)hydrazinylidene]methyl]-4-methoxyphenyl] 1-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-[2-[(E)-[1,3-benzothiazol-2-yl(phenacyl)hydrazinylidene]methyl]-4-methoxyphenyl] 1-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 135128365 |
| Molecular Formula | C46H47N3O9S |
| Molecular Weight | 817.96 g/mol |
| Exact Mass | 817.30 |
| IUPAC Name | 4-O-[2-[(E)-[1,3-benzothiazol-2-yl(phenacyl)hydrazinylidene]methyl]-4-methoxyphenyl] 1-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] cyclohexane-1,4-dicarboxylate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(OC(=O)C2CCC(C(=O)Oc3ccc(OC)cc3/C=N/N(CC(=O)c3ccccc3)c3nc4ccccc4s3)CC2)cc1 |
| InChI | InChI=1S/C46H47N3O9S/c1-3-43(51)56-28-12-5-4-11-27-55-36-21-23-37(24-22-36)57-44(52)33-17-19-34(20-18-33)45(53)58-41-26-25-38(54-2)29-35(41)30-47-49(31-40(50)32-13-7-6-8-14-32)46-48-39-15-9-10-16-42(39)59-46/h3,6-10,13-16,21-26,29-30,33-34H,1,4-5,11-12,17-20,27-28,31H2,2H3/b47-30+ |
| InChIKey | CEVYEBDEUZRVHH-PVDFOBQKSA-N |
| XLogP | 9.01 |
| TPSA | 142.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.96 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|