C47H53N3O7S — CID 168734528
4-O-[3-[(E)-[1,3-benzothiazol-2-yl(hexyl)hydrazinylidene]methyl]naphthalen-2-yl] 1-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] cyclohexane-1,4-dicarboxylate (PubChem CID 168734528) has the molecular formula C47H53N3O7S and a molecular weight of 804.02 g/mol. Its IUPAC name is 4-O-[3-[(E)-[1,3-benzothiazol-2-yl(hexyl)hydrazinylidene]methyl]naphthalen-2-yl] 1-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-[3-[(E)-[1,3-benzothiazol-2-yl(hexyl)hydrazinylidene]methyl]naphthalen-2-yl] 1-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 168734528 |
| Molecular Formula | C47H53N3O7S |
| Molecular Weight | 804.02 g/mol |
| Exact Mass | 803.36 |
| IUPAC Name | 4-O-[3-[(E)-[1,3-benzothiazol-2-yl(hexyl)hydrazinylidene]methyl]naphthalen-2-yl] 1-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] cyclohexane-1,4-dicarboxylate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(OC(=O)C2CCC(C(=O)Oc3cc4ccccc4cc3/C=N/N(CCCCCC)c3nc4ccccc4s3)CC2)cc1 |
| InChI | InChI=1S/C47H53N3O7S/c1-3-5-6-13-28-50(47-49-41-18-11-12-19-43(41)58-47)48-33-38-31-36-16-9-10-17-37(36)32-42(38)57-46(53)35-22-20-34(21-23-35)45(52)56-40-26-24-39(25-27-40)54-29-14-7-8-15-30-55-44(51)4-2/h4,9-12,16-19,24-27,31-35H,2-3,5-8,13-15,20-23,28-30H2,1H3/b48-33+ |
| InChIKey | ZKTBNHQNNVUFLA-URCPGLGISA-N |
| XLogP | 10.86 |
| TPSA | 116.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.02 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|