C47H59N3O7S — CID 165160122
[2-[(E)-[1,3-benzothiazol-2-yl(hexyl)hydrazinylidene]methyl]-4-(4-butylcyclohexanecarbonyl)oxyphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 165160122) has the molecular formula C47H59N3O7S and a molecular weight of 810.07 g/mol. Its IUPAC name is [2-[(E)-[1,3-benzothiazol-2-yl(hexyl)hydrazinylidene]methyl]-4-(4-butylcyclohexanecarbonyl)oxyphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | [2-[(E)-[1,3-benzothiazol-2-yl(hexyl)hydrazinylidene]methyl]-4-(4-butylcyclohexanecarbonyl)oxyphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 165160122 |
| Molecular Formula | C47H59N3O7S |
| Molecular Weight | 810.07 g/mol |
| Exact Mass | 809.41 |
| IUPAC Name | [2-[(E)-[1,3-benzothiazol-2-yl(hexyl)hydrazinylidene]methyl]-4-(4-butylcyclohexanecarbonyl)oxyphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)C3CCC(CCCC)CC3)cc2/C=N/N(CCCCCC)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C47H59N3O7S/c1-4-7-9-14-30-50(47-49-41-18-12-13-19-43(41)58-47)48-34-38-33-40(56-45(52)36-22-20-35(21-23-36)17-8-5-2)28-29-42(38)57-46(53)37-24-26-39(27-25-37)54-31-15-10-11-16-32-55-44(51)6-3/h6,12-13,18-19,24-29,33-36H,3-5,7-11,14-17,20-23,30-32H2,1-2H3/b48-34+ |
| InChIKey | LMJIGJBEKBNGHQ-NDAHQLQXSA-N |
| XLogP | 11.51 |
| TPSA | 116.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.07 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|