C42H43N3O9S — CID 126658696
4-O-[2-[(E)-[1,3-benzothiazol-2-yl(but-2-ynyl)hydrazinylidene]methyl]-4-formyloxyphenyl] 1-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] cyclohexane-1,4-dicarboxylate (PubChem CID 126658696) has the molecular formula C42H43N3O9S and a molecular weight of 765.88 g/mol. Its IUPAC name is 4-O-[2-[(E)-[1,3-benzothiazol-2-yl(but-2-ynyl)hydrazinylidene]methyl]-4-formyloxyphenyl] 1-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-[2-[(E)-[1,3-benzothiazol-2-yl(but-2-ynyl)hydrazinylidene]methyl]-4-formyloxyphenyl] 1-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 126658696 |
| Molecular Formula | C42H43N3O9S |
| Molecular Weight | 765.88 g/mol |
| Exact Mass | 765.27 |
| IUPAC Name | 4-O-[2-[(E)-[1,3-benzothiazol-2-yl(but-2-ynyl)hydrazinylidene]methyl]-4-formyloxyphenyl] 1-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] cyclohexane-1,4-dicarboxylate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(OC(=O)C2CCC(C(=O)Oc3ccc(OC=O)cc3/C=N/N(CC#CC)c3nc4ccccc4s3)CC2)cc1 |
| InChI | InChI=1S/C42H43N3O9S/c1-3-5-24-45(42-44-36-12-8-9-13-38(36)55-42)43-28-32-27-35(52-29-46)22-23-37(32)54-41(49)31-16-14-30(15-17-31)40(48)53-34-20-18-33(19-21-34)50-25-10-6-7-11-26-51-39(47)4-2/h4,8-9,12-13,18-23,27-31H,2,6-7,10-11,14-17,24-26H2,1H3/b43-28+ |
| InChIKey | IUAJQVUQAPIALT-PNHGISFSSA-N |
| XLogP | 7.68 |
| TPSA | 142.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.88 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|