C26H31N3O4S — CID 137047670
[3-[(E)-[1,3-benzothiazol-2-yl(hexyl)hydrazinylidene]methyl]-4-hydroxyphenyl] 6-oxohexanoate (PubChem CID 137047670) has the molecular formula C26H31N3O4S and a molecular weight of 481.62 g/mol. Its IUPAC name is [3-[(E)-[1,3-benzothiazol-2-yl(hexyl)hydrazinylidene]methyl]-4-hydroxyphenyl] 6-oxohexanoate.
| Compound Name | [3-[(E)-[1,3-benzothiazol-2-yl(hexyl)hydrazinylidene]methyl]-4-hydroxyphenyl] 6-oxohexanoate |
|---|---|
| PubChem CID | 137047670 |
| Molecular Formula | C26H31N3O4S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | [3-[(E)-[1,3-benzothiazol-2-yl(hexyl)hydrazinylidene]methyl]-4-hydroxyphenyl] 6-oxohexanoate |
| SMILES | CCCCCCN(/N=C/c1cc(OC(=O)CCCCC=O)ccc1O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C26H31N3O4S/c1-2-3-4-9-16-29(26-28-22-11-7-8-12-24(22)34-26)27-19-20-18-21(14-15-23(20)31)33-25(32)13-6-5-10-17-30/h7-8,11-12,14-15,17-19,31H,2-6,9-10,13,16H2,1H3/b27-19+ |
| InChIKey | GIRXAYSFSNENFC-ZXVVBBHZSA-N |
| XLogP | 6.09 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|