C50H59N3O8S — CID 129146506
6-[4-[[3-[(E)-[1,3-benzothiazol-2-yl(butyl)hydrazinylidene]methyl]-4-[[4-(6-prop-2-enoyloxyhexoxy)phenyl]methoxy]phenoxy]methyl]phenoxy]hexyl prop-2-enoate (PubChem CID 129146506) has the molecular formula C50H59N3O8S and a molecular weight of 862.10 g/mol. Its IUPAC name is 6-[4-[[3-[(E)-[1,3-benzothiazol-2-yl(butyl)hydrazinylidene]methyl]-4-[[4-(6-prop-2-enoyloxyhexoxy)phenyl]methoxy]phenoxy]methyl]phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[4-[[3-[(E)-[1,3-benzothiazol-2-yl(butyl)hydrazinylidene]methyl]-4-[[4-(6-prop-2-enoyloxyhexoxy)phenyl]methoxy]phenoxy]methyl]phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 129146506 |
| Molecular Formula | C50H59N3O8S |
| Molecular Weight | 862.10 g/mol |
| Exact Mass | 861.40 |
| IUPAC Name | 6-[4-[[3-[(E)-[1,3-benzothiazol-2-yl(butyl)hydrazinylidene]methyl]-4-[[4-(6-prop-2-enoyloxyhexoxy)phenyl]methoxy]phenoxy]methyl]phenoxy]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(COc2ccc(OCc3ccc(OCCCCCCOC(=O)C=C)cc3)c(/C=N/N(CCCC)c3nc4ccccc4s3)c2)cc1 |
| InChI | InChI=1S/C50H59N3O8S/c1-4-7-30-53(50-52-45-18-12-13-19-47(45)62-50)51-36-41-35-44(60-37-39-20-24-42(25-21-39)56-31-14-8-10-16-33-58-48(54)5-2)28-29-46(41)61-38-40-22-26-43(27-23-40)57-32-15-9-11-17-34-59-49(55)6-3/h5-6,12-13,18-29,35-36H,2-4,7-11,14-17,30-34,37-38H2,1H3/b51-36+ |
| InChIKey | GDEYDZLRZFKDHI-CBEHHUQSSA-N |
| XLogP | 11.43 |
| TPSA | 118.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.10 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|