C43H41F4N3O4S2 — CID 129146673
[4-[[2-[(E)-[1,3-benzothiazol-2-yl(4,4,4-trifluorobutyl)hydrazinylidene]methyl]-4-methylphenoxy]methyl]-2-fluorophenyl] 6-(6-sulfanylhexoxy)naphthalene-2-carboxylate (PubChem CID 129146673) has the molecular formula C43H41F4N3O4S2 and a molecular weight of 803.94 g/mol. Its IUPAC name is [4-[[2-[(E)-[1,3-benzothiazol-2-yl(4,4,4-trifluorobutyl)hydrazinylidene]methyl]-4-methylphenoxy]methyl]-2-fluorophenyl] 6-(6-sulfanylhexoxy)naphthalene-2-carboxylate.
| Compound Name | [4-[[2-[(E)-[1,3-benzothiazol-2-yl(4,4,4-trifluorobutyl)hydrazinylidene]methyl]-4-methylphenoxy]methyl]-2-fluorophenyl] 6-(6-sulfanylhexoxy)naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 129146673 |
| Molecular Formula | C43H41F4N3O4S2 |
| Molecular Weight | 803.94 g/mol |
| Exact Mass | 803.25 |
| IUPAC Name | [4-[[2-[(E)-[1,3-benzothiazol-2-yl(4,4,4-trifluorobutyl)hydrazinylidene]methyl]-4-methylphenoxy]methyl]-2-fluorophenyl] 6-(6-sulfanylhexoxy)naphthalene-2-carboxylate |
| SMILES | Cc1ccc(OCc2ccc(OC(=O)c3ccc4cc(OCCCCCCS)ccc4c3)c(F)c2)c(/C=N/N(CCCC(F)(F)F)c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C43H41F4N3O4S2/c1-29-11-17-38(34(23-29)27-48-50(20-8-19-43(45,46)47)42-49-37-9-4-5-10-40(37)56-42)53-28-30-12-18-39(36(44)24-30)54-41(51)33-14-13-32-26-35(16-15-31(32)25-33)52-21-6-2-3-7-22-55/h4-5,9-18,23-27,55H,2-3,6-8,19-22,28H2,1H3/b48-27+ |
| InChIKey | HRYHRHIQYUCCNV-AKGVSSOZSA-N |
| XLogP | 11.75 |
| TPSA | 73.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.94 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|