C36H35N3O6S — CID 138642874
[3-[(E)-[1,3-benzothiazol-2-yl-(4-methylphenyl)hydrazinylidene]methyl]-4-methoxyphenyl] 4-(6-formyloxyhexoxy)benzoate (PubChem CID 138642874) has the molecular formula C36H35N3O6S and a molecular weight of 637.76 g/mol. Its IUPAC name is [3-[(E)-[1,3-benzothiazol-2-yl-(4-methylphenyl)hydrazinylidene]methyl]-4-methoxyphenyl] 4-(6-formyloxyhexoxy)benzoate.
| Compound Name | [3-[(E)-[1,3-benzothiazol-2-yl-(4-methylphenyl)hydrazinylidene]methyl]-4-methoxyphenyl] 4-(6-formyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 138642874 |
| Molecular Formula | C36H35N3O6S |
| Molecular Weight | 637.76 g/mol |
| Exact Mass | 637.22 |
| IUPAC Name | [3-[(E)-[1,3-benzothiazol-2-yl-(4-methylphenyl)hydrazinylidene]methyl]-4-methoxyphenyl] 4-(6-formyloxyhexoxy)benzoate |
| SMILES | COc1ccc(OC(=O)c2ccc(OCCCCCCOC=O)cc2)cc1/C=N/N(c1ccc(C)cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C36H35N3O6S/c1-26-11-15-29(16-12-26)39(36-38-32-9-5-6-10-34(32)46-36)37-24-28-23-31(19-20-33(28)42-2)45-35(41)27-13-17-30(18-14-27)44-22-8-4-3-7-21-43-25-40/h5-6,9-20,23-25H,3-4,7-8,21-22H2,1-2H3/b37-24+ |
| InChIKey | YJSVNCJRUHHMFH-HWLOXFRGSA-N |
| XLogP | 8.12 |
| TPSA | 99.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.76 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|