C47H49N3O10S — CID 123531165
[3-[[1,3-benzothiazol-2-yl(benzyl)hydrazinylidene]methyl]-4-(6-prop-2-enoyloxyhexoxycarbonyloxy)phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 123531165) has the molecular formula C47H49N3O10S and a molecular weight of 847.99 g/mol. Its IUPAC name is [3-[[1,3-benzothiazol-2-yl(benzyl)hydrazinylidene]methyl]-4-(6-prop-2-enoyloxyhexoxycarbonyloxy)phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | [3-[[1,3-benzothiazol-2-yl(benzyl)hydrazinylidene]methyl]-4-(6-prop-2-enoyloxyhexoxycarbonyloxy)phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 123531165 |
| Molecular Formula | C47H49N3O10S |
| Molecular Weight | 847.99 g/mol |
| Exact Mass | 847.31 |
| IUPAC Name | [3-[[1,3-benzothiazol-2-yl(benzyl)hydrazinylidene]methyl]-4-(6-prop-2-enoyloxyhexoxycarbonyloxy)phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | C=CC(=O)OCCCCCCOC(=O)Oc1ccc(OC(=O)c2ccc(OCCCCCCOC(=O)C=C)cc2)cc1C=NN(Cc1ccccc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C47H49N3O10S/c1-3-43(51)56-29-15-6-5-14-28-55-38-24-22-36(23-25-38)45(53)59-39-26-27-41(60-47(54)58-31-17-8-7-16-30-57-44(52)4-2)37(32-39)33-48-50(34-35-18-10-9-11-19-35)46-49-40-20-12-13-21-42(40)61-46/h3-4,9-13,18-27,32-33H,1-2,5-8,14-17,28-31,34H2 |
| InChIKey | QZDAARAGYNJLBZ-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 152.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.99 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|