C28H27N3O6S — CID 142383916
[2-[(E)-[1,3-benzothiazol-2-yl(methyl)hydrazinylidene]methyl]-4-methoxyphenyl] 4-[(2-methylpropan-2-yl)oxycarbonyloxy]benzoate (PubChem CID 142383916) has the molecular formula C28H27N3O6S and a molecular weight of 533.61 g/mol. Its IUPAC name is [2-[(E)-[1,3-benzothiazol-2-yl(methyl)hydrazinylidene]methyl]-4-methoxyphenyl] 4-[(2-methylpropan-2-yl)oxycarbonyloxy]benzoate.
| Compound Name | [2-[(E)-[1,3-benzothiazol-2-yl(methyl)hydrazinylidene]methyl]-4-methoxyphenyl] 4-[(2-methylpropan-2-yl)oxycarbonyloxy]benzoate |
|---|---|
| PubChem CID | 142383916 |
| Molecular Formula | C28H27N3O6S |
| Molecular Weight | 533.61 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | [2-[(E)-[1,3-benzothiazol-2-yl(methyl)hydrazinylidene]methyl]-4-methoxyphenyl] 4-[(2-methylpropan-2-yl)oxycarbonyloxy]benzoate |
| SMILES | COc1ccc(OC(=O)c2ccc(OC(=O)OC(C)(C)C)cc2)c(/C=N/N(C)c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C28H27N3O6S/c1-28(2,3)37-27(33)35-20-12-10-18(11-13-20)25(32)36-23-15-14-21(34-5)16-19(23)17-29-31(4)26-30-22-8-6-7-9-24(22)38-26/h6-17H,1-5H3/b29-17+ |
| InChIKey | BPGDOGMVVHBICL-STBIYBPSSA-N |
| XLogP | 6.31 |
| TPSA | 99.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.61 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|