C35H31N3O5S — CID 153412739
[3-[(E)-[1,3-benzothiazol-2-yl(methyl)hydrazinylidene]methyl]-4-(4-propylphenyl)phenyl] 4-(prop-2-enoyloxymethoxy)benzoate (PubChem CID 153412739) has the molecular formula C35H31N3O5S and a molecular weight of 605.72 g/mol. Its IUPAC name is [3-[(E)-[1,3-benzothiazol-2-yl(methyl)hydrazinylidene]methyl]-4-(4-propylphenyl)phenyl] 4-(prop-2-enoyloxymethoxy)benzoate.
| Compound Name | [3-[(E)-[1,3-benzothiazol-2-yl(methyl)hydrazinylidene]methyl]-4-(4-propylphenyl)phenyl] 4-(prop-2-enoyloxymethoxy)benzoate |
|---|---|
| PubChem CID | 153412739 |
| Molecular Formula | C35H31N3O5S |
| Molecular Weight | 605.72 g/mol |
| Exact Mass | 605.20 |
| IUPAC Name | [3-[(E)-[1,3-benzothiazol-2-yl(methyl)hydrazinylidene]methyl]-4-(4-propylphenyl)phenyl] 4-(prop-2-enoyloxymethoxy)benzoate |
| SMILES | C=CC(=O)OCOc1ccc(C(=O)Oc2ccc(-c3ccc(CCC)cc3)c(/C=N/N(C)c3nc4ccccc4s3)c2)cc1 |
| InChI | InChI=1S/C35H31N3O5S/c1-4-8-24-11-13-25(14-12-24)30-20-19-29(43-34(40)26-15-17-28(18-16-26)41-23-42-33(39)5-2)21-27(30)22-36-38(3)35-37-31-9-6-7-10-32(31)44-35/h5-7,9-22H,2,4,8,23H2,1,3H3/b36-22+ |
| InChIKey | HXWYVGSDHPEDDD-HPNXWYHWSA-N |
| XLogP | 7.67 |
| TPSA | 90.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.72 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|