C41H41N3O7S — CID 134309697
pentyl 4-[3-[(E)-[1,3-benzothiazol-2-yl(methyl)hydrazinylidene]methyl]-4-[4-[3-(2-methylprop-2-enoyloxy)propoxy]benzoyl]oxyphenyl]benzoate (PubChem CID 134309697) has the molecular formula C41H41N3O7S and a molecular weight of 719.86 g/mol. Its IUPAC name is pentyl 4-[3-[(E)-[1,3-benzothiazol-2-yl(methyl)hydrazinylidene]methyl]-4-[4-[3-(2-methylprop-2-enoyloxy)propoxy]benzoyl]oxyphenyl]benzoate.
| Compound Name | pentyl 4-[3-[(E)-[1,3-benzothiazol-2-yl(methyl)hydrazinylidene]methyl]-4-[4-[3-(2-methylprop-2-enoyloxy)propoxy]benzoyl]oxyphenyl]benzoate |
|---|---|
| PubChem CID | 134309697 |
| Molecular Formula | C41H41N3O7S |
| Molecular Weight | 719.86 g/mol |
| Exact Mass | 719.27 |
| IUPAC Name | pentyl 4-[3-[(E)-[1,3-benzothiazol-2-yl(methyl)hydrazinylidene]methyl]-4-[4-[3-(2-methylprop-2-enoyloxy)propoxy]benzoyl]oxyphenyl]benzoate |
| SMILES | C=C(C)C(=O)OCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(C(=O)OCCCCC)cc3)cc2/C=N/N(C)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C41H41N3O7S/c1-5-6-9-23-50-39(46)30-15-13-29(14-16-30)32-19-22-36(33(26-32)27-42-44(4)41-43-35-11-7-8-12-37(35)52-41)51-40(47)31-17-20-34(21-18-31)48-24-10-25-49-38(45)28(2)3/h7-8,11-22,26-27H,2,5-6,9-10,23-25H2,1,3-4H3/b42-27+ |
| InChIKey | YDRBIYASYFIGSB-UUFNBZTESA-N |
| XLogP | 8.89 |
| TPSA | 116.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.86 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|