C20H15N3O2S2 — CID 8608881
N-(1,3-benzothiazol-2-yl)-3-methoxy-N-[(Z)-thiophen-2-ylmethylideneamino]benzamide (PubChem CID 8608881) has the molecular formula C20H15N3O2S2 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-3-methoxy-N-[(Z)-thiophen-2-ylmethylideneamino]benzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-3-methoxy-N-[(Z)-thiophen-2-ylmethylideneamino]benzamide |
|---|---|
| PubChem CID | 8608881 |
| Molecular Formula | C20H15N3O2S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-3-methoxy-N-[(Z)-thiophen-2-ylmethylideneamino]benzamide |
| SMILES | COc1cccc(C(=O)N(/N=C\c2cccs2)c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C20H15N3O2S2/c1-25-15-7-4-6-14(12-15)19(24)23(21-13-16-8-5-11-26-16)20-22-17-9-2-3-10-18(17)27-20/h2-13H,1H3/b21-13- |
| InChIKey | RHVXZBXRXOGOAY-BKUYFWCQSA-N |
| XLogP | 5.05 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|