C22H16FN3O2S — CID 44942697
N-[(E)-benzylideneamino]-N-(6-fluoro-1,3-benzothiazol-2-yl)-3-methoxybenzamide (PubChem CID 44942697) has the molecular formula C22H16FN3O2S and a molecular weight of 405.45 g/mol. Its IUPAC name is N-[(E)-benzylideneamino]-N-(6-fluoro-1,3-benzothiazol-2-yl)-3-methoxybenzamide.
| Compound Name | N-[(E)-benzylideneamino]-N-(6-fluoro-1,3-benzothiazol-2-yl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 44942697 |
| Molecular Formula | C22H16FN3O2S |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | N-[(E)-benzylideneamino]-N-(6-fluoro-1,3-benzothiazol-2-yl)-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)N(/N=C/c2ccccc2)c2nc3ccc(F)cc3s2)c1 |
| InChI | InChI=1S/C22H16FN3O2S/c1-28-18-9-5-8-16(12-18)21(27)26(24-14-15-6-3-2-4-7-15)22-25-19-11-10-17(23)13-20(19)29-22/h2-14H,1H3/b24-14+ |
| InChIKey | LFQNJKCUWXEWBZ-ZVHZXABRSA-N |
| XLogP | 5.12 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|