C26H18FN3O2S — CID 44943579
N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]naphthalene-1-carboxamide (PubChem CID 44943579) has the molecular formula C26H18FN3O2S and a molecular weight of 455.51 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]naphthalene-1-carboxamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 44943579 |
| Molecular Formula | C26H18FN3O2S |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]naphthalene-1-carboxamide |
| SMILES | COc1ccc(/C=N/N(C(=O)c2cccc3ccccc23)c2nc3ccc(F)cc3s2)cc1 |
| InChI | InChI=1S/C26H18FN3O2S/c1-32-20-12-9-17(10-13-20)16-28-30(26-29-23-14-11-19(27)15-24(23)33-26)25(31)22-8-4-6-18-5-2-3-7-21(18)22/h2-16H,1H3/b28-16+ |
| InChIKey | OOBWGPHQIKRESN-LQKURTRISA-N |
| XLogP | 6.28 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|