C23H17FN4O5S — CID 44943412
N-(6-fluoro-1,3-benzothiazol-2-yl)-2,3-dimethoxy-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide (PubChem CID 44943412) has the molecular formula C23H17FN4O5S and a molecular weight of 480.48 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-2,3-dimethoxy-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-2,3-dimethoxy-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44943412 |
| Molecular Formula | C23H17FN4O5S |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-2,3-dimethoxy-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide |
| SMILES | COc1cccc(C(=O)N(/N=C/c2ccc([N+](=O)[O-])cc2)c2nc3ccc(F)cc3s2)c1OC |
| InChI | InChI=1S/C23H17FN4O5S/c1-32-19-5-3-4-17(21(19)33-2)22(29)27(23-26-18-11-8-15(24)12-20(18)34-23)25-13-14-6-9-16(10-7-14)28(30)31/h3-13H,1-2H3/b25-13+ |
| InChIKey | UBPACCGAORFISB-DHRITJCHSA-N |
| XLogP | 5.04 |
| TPSA | 107.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|