C23H18FN5O5S2 — CID 44943343
4-(dimethylsulfamoyl)-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide (PubChem CID 44943343) has the molecular formula C23H18FN5O5S2 and a molecular weight of 527.56 g/mol. Its IUPAC name is 4-(dimethylsulfamoyl)-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide.
| Compound Name | 4-(dimethylsulfamoyl)-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44943343 |
| Molecular Formula | C23H18FN5O5S2 |
| Molecular Weight | 527.56 g/mol |
| Exact Mass | 527.07 |
| IUPAC Name | 4-(dimethylsulfamoyl)-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)N(/N=C/c2ccc([N+](=O)[O-])cc2)c2nc3ccc(F)cc3s2)cc1 |
| InChI | InChI=1S/C23H18FN5O5S2/c1-27(2)36(33,34)19-10-5-16(6-11-19)22(30)28(23-26-20-12-7-17(24)13-21(20)35-23)25-14-15-3-8-18(9-4-15)29(31)32/h3-14H,1-2H3/b25-14+ |
| InChIKey | CREFCOOVDARYBQ-AFUMVMLFSA-N |
| XLogP | 4.27 |
| TPSA | 126.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|