C28H29N5O6S2 — CID 44945772
4-(dipropylsulfamoyl)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide (PubChem CID 44945772) has the molecular formula C28H29N5O6S2 and a molecular weight of 595.70 g/mol. Its IUPAC name is 4-(dipropylsulfamoyl)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide.
| Compound Name | 4-(dipropylsulfamoyl)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44945772 |
| Molecular Formula | C28H29N5O6S2 |
| Molecular Weight | 595.70 g/mol |
| Exact Mass | 595.16 |
| IUPAC Name | 4-(dipropylsulfamoyl)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(C(=O)N(/N=C/c2ccc([N+](=O)[O-])cc2)c2nc3ccc(OC)cc3s2)cc1 |
| InChI | InChI=1S/C28H29N5O6S2/c1-4-16-31(17-5-2)41(37,38)24-13-8-21(9-14-24)27(34)32(29-19-20-6-10-22(11-7-20)33(35)36)28-30-25-15-12-23(39-3)18-26(25)40-28/h6-15,18-19H,4-5,16-17H2,1-3H3/b29-19+ |
| InChIKey | NJLAPXUSZWNWIV-VUTHCHCSSA-N |
| XLogP | 5.70 |
| TPSA | 135.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.70 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|