C24H20N4O6S — CID 44945764
3,5-dimethoxy-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide (PubChem CID 44945764) has the molecular formula C24H20N4O6S and a molecular weight of 492.51 g/mol. Its IUPAC name is 3,5-dimethoxy-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide.
| Compound Name | 3,5-dimethoxy-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44945764 |
| Molecular Formula | C24H20N4O6S |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | 3,5-dimethoxy-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)N(/N=C/c2ccc([N+](=O)[O-])cc2)c2nc3ccc(OC)cc3s2)c1 |
| InChI | InChI=1S/C24H20N4O6S/c1-32-18-8-9-21-22(13-18)35-24(26-21)27(25-14-15-4-6-17(7-5-15)28(30)31)23(29)16-10-19(33-2)12-20(11-16)34-3/h4-14H,1-3H3/b25-14+ |
| InChIKey | NLNPMKYIHHXLHC-AFUMVMLFSA-N |
| XLogP | 4.91 |
| TPSA | 116.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|