C22H18N4O7S — CID 44946142
3,5-dimethoxy-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]benzamide (PubChem CID 44946142) has the molecular formula C22H18N4O7S and a molecular weight of 482.47 g/mol. Its IUPAC name is 3,5-dimethoxy-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]benzamide.
| Compound Name | 3,5-dimethoxy-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44946142 |
| Molecular Formula | C22H18N4O7S |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | 3,5-dimethoxy-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)N(/N=C/c2ccc([N+](=O)[O-])o2)c2nc3ccc(OC)cc3s2)c1 |
| InChI | InChI=1S/C22H18N4O7S/c1-30-14-4-6-18-19(11-14)34-22(24-18)25(23-12-15-5-7-20(33-15)26(28)29)21(27)13-8-16(31-2)10-17(9-13)32-3/h4-12H,1-3H3/b23-12+ |
| InChIKey | PJWOJKQUHKRGKT-FSJBWODESA-N |
| XLogP | 4.50 |
| TPSA | 129.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|