C25H20N4O5S — CID 44945985
(E)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 44945985) has the molecular formula C25H20N4O5S and a molecular weight of 488.53 g/mol. Its IUPAC name is (E)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 44945985 |
| Molecular Formula | C25H20N4O5S |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | (E)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=N/N(C(=O)/C=C/c2ccc([N+](=O)[O-])cc2)c2nc3ccc(OC)cc3s2)cc1 |
| InChI | InChI=1S/C25H20N4O5S/c1-33-20-10-5-18(6-11-20)16-26-28(25-27-22-13-12-21(34-2)15-23(22)35-25)24(30)14-7-17-3-8-19(9-4-17)29(31)32/h3-16H,1-2H3/b14-7+,26-16+ |
| InChIKey | QOGCERDSFVWAGK-NMKFMISUSA-N |
| XLogP | 5.30 |
| TPSA | 107.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|