C24H17BrN4O4S — CID 44945248
(E)-N-[(E)-(4-bromophenyl)methylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 44945248) has the molecular formula C24H17BrN4O4S and a molecular weight of 537.40 g/mol. Its IUPAC name is (E)-N-[(E)-(4-bromophenyl)methylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[(E)-(4-bromophenyl)methylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 44945248 |
| Molecular Formula | C24H17BrN4O4S |
| Molecular Weight | 537.40 g/mol |
| Exact Mass | 536.02 |
| IUPAC Name | (E)-N-[(E)-(4-bromophenyl)methylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | COc1ccc2nc(N(/N=C/c3ccc(Br)cc3)C(=O)/C=C/c3ccc([N+](=O)[O-])cc3)sc2c1 |
| InChI | InChI=1S/C24H17BrN4O4S/c1-33-20-11-12-21-22(14-20)34-24(27-21)28(26-15-17-2-7-18(25)8-3-17)23(30)13-6-16-4-9-19(10-5-16)29(31)32/h2-15H,1H3/b13-6+,26-15+ |
| InChIKey | BHRURAAJKMMLMT-XQXQFYKFSA-N |
| XLogP | 6.06 |
| TPSA | 97.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.40 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|