C29H23N3O3S — CID 44945943
N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]-4-phenylbenzamide (PubChem CID 44945943) has the molecular formula C29H23N3O3S and a molecular weight of 493.59 g/mol. Its IUPAC name is N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]-4-phenylbenzamide.
| Compound Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]-4-phenylbenzamide |
|---|---|
| PubChem CID | 44945943 |
| Molecular Formula | C29H23N3O3S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]-4-phenylbenzamide |
| SMILES | COc1ccc(/C=N/N(C(=O)c2ccc(-c3ccccc3)cc2)c2nc3ccc(OC)cc3s2)cc1 |
| InChI | InChI=1S/C29H23N3O3S/c1-34-24-14-8-20(9-15-24)19-30-32(29-31-26-17-16-25(35-2)18-27(26)36-29)28(33)23-12-10-22(11-13-23)21-6-4-3-5-7-21/h3-19H,1-2H3/b30-19+ |
| InChIKey | LUQDORUTFMOJMF-NDZAJKAJSA-N |
| XLogP | 6.66 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|