C26H23N3O4S — CID 44945319
4-acetyl-N-[(E)-(4-ethoxyphenyl)methylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide (PubChem CID 44945319) has the molecular formula C26H23N3O4S and a molecular weight of 473.55 g/mol. Its IUPAC name is 4-acetyl-N-[(E)-(4-ethoxyphenyl)methylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 4-acetyl-N-[(E)-(4-ethoxyphenyl)methylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 44945319 |
| Molecular Formula | C26H23N3O4S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 4-acetyl-N-[(E)-(4-ethoxyphenyl)methylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCOc1ccc(/C=N/N(C(=O)c2ccc(C(C)=O)cc2)c2nc3ccc(OC)cc3s2)cc1 |
| InChI | InChI=1S/C26H23N3O4S/c1-4-33-21-11-5-18(6-12-21)16-27-29(25(31)20-9-7-19(8-10-20)17(2)30)26-28-23-14-13-22(32-3)15-24(23)34-26/h5-16H,4H2,1-3H3/b27-16+ |
| InChIKey | WICVOXQZPOWRNC-JVWAILMASA-N |
| XLogP | 5.59 |
| TPSA | 81.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|