C41H47N3O6S — CID 135128394
4-O-[3-[(E)-[1,3-benzothiazol-2-yl(2-methylprop-2-enyl)hydrazinylidene]methyl]-4-methoxyphenyl] 1-O-(4-oct-7-enoxyphenyl) cyclohexane-1,4-dicarboxylate (PubChem CID 135128394) has the molecular formula C41H47N3O6S and a molecular weight of 709.91 g/mol. Its IUPAC name is 4-O-[3-[(E)-[1,3-benzothiazol-2-yl(2-methylprop-2-enyl)hydrazinylidene]methyl]-4-methoxyphenyl] 1-O-(4-oct-7-enoxyphenyl) cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-[3-[(E)-[1,3-benzothiazol-2-yl(2-methylprop-2-enyl)hydrazinylidene]methyl]-4-methoxyphenyl] 1-O-(4-oct-7-enoxyphenyl) cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 135128394 |
| Molecular Formula | C41H47N3O6S |
| Molecular Weight | 709.91 g/mol |
| Exact Mass | 709.32 |
| IUPAC Name | 4-O-[3-[(E)-[1,3-benzothiazol-2-yl(2-methylprop-2-enyl)hydrazinylidene]methyl]-4-methoxyphenyl] 1-O-(4-oct-7-enoxyphenyl) cyclohexane-1,4-dicarboxylate |
| SMILES | C=CCCCCCCOc1ccc(OC(=O)C2CCC(C(=O)Oc3ccc(OC)c(/C=N/N(CC(=C)C)c4nc5ccccc5s4)c3)CC2)cc1 |
| InChI | InChI=1S/C41H47N3O6S/c1-5-6-7-8-9-12-25-48-33-19-21-34(22-20-33)49-39(45)30-15-17-31(18-16-30)40(46)50-35-23-24-37(47-4)32(26-35)27-42-44(28-29(2)3)41-43-36-13-10-11-14-38(36)51-41/h5,10-11,13-14,19-24,26-27,30-31H,1-2,6-9,12,15-18,25,28H2,3-4H3/b42-27+ |
| InChIKey | XBMVZAZVSDSRCP-UUFNBZTESA-N |
| XLogP | 9.55 |
| TPSA | 99.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.91 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|