C47H61N3O7S — CID 145109676
4-O-[2-[(E)-[1,3-benzothiazol-2-yl(hexyl)hydrazinylidene]methyl]-4-(4-propylcyclohexyl)phenyl] 1-O-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl] cyclohexane-1,4-dicarboxylate (PubChem CID 145109676) has the molecular formula C47H61N3O7S and a molecular weight of 812.09 g/mol. Its IUPAC name is 4-O-[2-[(E)-[1,3-benzothiazol-2-yl(hexyl)hydrazinylidene]methyl]-4-(4-propylcyclohexyl)phenyl] 1-O-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-[2-[(E)-[1,3-benzothiazol-2-yl(hexyl)hydrazinylidene]methyl]-4-(4-propylcyclohexyl)phenyl] 1-O-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 145109676 |
| Molecular Formula | C47H61N3O7S |
| Molecular Weight | 812.09 g/mol |
| Exact Mass | 811.42 |
| IUPAC Name | 4-O-[2-[(E)-[1,3-benzothiazol-2-yl(hexyl)hydrazinylidene]methyl]-4-(4-propylcyclohexyl)phenyl] 1-O-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl] cyclohexane-1,4-dicarboxylate |
| SMILES | CCCCCCN(/N=C/c1cc(C2CCC(CCC)CC2)ccc1OC(=O)C1CCC(C(=O)Oc2ccc(OCCOCCO)cc2)CC1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C47H61N3O7S/c1-3-5-6-9-27-50(47-49-42-11-7-8-12-44(42)58-47)48-33-39-32-38(35-15-13-34(10-4-2)14-16-35)21-26-43(39)57-46(53)37-19-17-36(18-20-37)45(52)56-41-24-22-40(23-25-41)55-31-30-54-29-28-51/h7-8,11-12,21-26,32-37,51H,3-6,9-10,13-20,27-31H2,1-2H3/b48-33+ |
| InChIKey | WAPHQWSPPBWIEA-URCPGLGISA-N |
| XLogP | 10.50 |
| TPSA | 119.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.09 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|